CAS 870614-09-8 is the registry number for 2-Bromo-1-(tert-butoxy)-4-chlorobenzene, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4-chloro-1-[(2-methylpropan-2-yl)oxy]benzene (CAS 870614-09-8) is a chemical compound with the molecular formula C10H12BrClO and a molecular weight of 263.56 g/mol. IUPAC name: 2-bromo-4-chloro-1-[(2-methylpropan-2-yl)oxy]benzene. InChIKey: CMVKXFGMMCMZDG-UHFFFAOYSA-N.
| Molecular formula | C10H12BrClO |
|---|---|
| Molecular weight | 263.56 g/mol |
| IUPAC name | 2-bromo-4-chloro-1-[(2-methylpropan-2-yl)oxy]benzene |
| InChIKey | CMVKXFGMMCMZDG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C(C=C(C=C1)Cl)Br |
Computed by PubChem (NCBI)