Products 870614-18-9
CAS 870614-18-9 is the registry number for OBHS. Offered by: MedChemExpress. Available pack sizes: Get quote.
Phenyl (1R,2S,4R)-5,6-bis(4-hydroxyphenyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-sulfonate (CAS 870614-18-9) is a chemical compound with the molecular formula C24H20O6S and a molecular weight of 436.5 g/mol. IUPAC name: phenyl (1R,2S,4R)-5,6-bis(4-hydroxyphenyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-sulfonate. InChIKey: KRJVPVGVFUQQGQ-DPLHUUCSSA-N.
| Molecular formula | C24H20O6S |
|---|---|
| Molecular weight | 436.5 g/mol |
| IUPAC name | phenyl (1R,2S,4R)-5,6-bis(4-hydroxyphenyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-sulfonate |
| InChIKey | KRJVPVGVFUQQGQ-DPLHUUCSSA-N |
| SMILES | C1[C@@H]([C@H]2C(=C([C@@H]1O2)C3=CC=C(C=C3)O)C4=CC=C(C=C4)O)S(=O)(=O)OC5=CC=CC=C5 |
Computed by PubChem (NCBI)