CAS 870640-64-5 is the registry number for Monomethyl auristatin E intermediate-13. Offered by: MedChemExpress. Available pack sizes: Get quote.
Tert-butyl (3R,4S,5S)-4-[benzyl(methyl)amino]-3-methoxy-5-methylheptanoate (CAS 870640-64-5) is a chemical compound with the molecular formula C21H35NO3 and a molecular weight of 349.5 g/mol. IUPAC name: tert-butyl (3R,4S,5S)-4-[benzyl(methyl)amino]-3-methoxy-5-methylheptanoate. InChIKey: FJVJLCHQFIDUCO-HQRMLTQVSA-N.
| Molecular formula | C21H35NO3 |
|---|---|
| Molecular weight | 349.5 g/mol |
| IUPAC name | tert-butyl (3R,4S,5S)-4-[benzyl(methyl)amino]-3-methoxy-5-methylheptanoate |
| InChIKey | FJVJLCHQFIDUCO-HQRMLTQVSA-N |
| SMILES | CC[C@H](C)[C@@H]([C@@H](CC(=O)OC(C)(C)C)OC)N(C)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)