CAS 870640-68-9 is the registry number for tert-Butyl (3R,4S)-3-methoxy-5-methyl-4-(methylamino)hexanoate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (3R,4S)-3-methoxy-5-methyl-4-(methylamino)hexanoate;hydrochloride (CAS 870640-68-9) is a chemical compound with the molecular formula C13H28ClNO3 and a molecular weight of 281.82 g/mol. IUPAC name: tert-butyl (3R,4S)-3-methoxy-5-methyl-4-(methylamino)hexanoate;hydrochloride. InChIKey: XMXUSQZHXIPSEX-IYJPBCIQSA-N.
| Molecular formula | C13H28ClNO3 |
|---|---|
| Molecular weight | 281.82 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-methoxy-5-methyl-4-(methylamino)hexanoate;hydrochloride |
| InChIKey | XMXUSQZHXIPSEX-IYJPBCIQSA-N |
| SMILES | CC(C)[C@@H]([C@@H](CC(=O)OC(C)(C)C)OC)NC.Cl |
Computed by PubChem (NCBI)