CAS 870703-63-2 is the registry number for N,N-Di-Boc-2-aminopyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-pyridin-2-ylcarbamate (CAS 870703-63-2) is a chemical compound with the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. IUPAC name: tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-pyridin-2-ylcarbamate. InChIKey: QLOPVAOGSSBUEH-UHFFFAOYSA-N.
| Molecular formula | C15H22N2O4 |
|---|---|
| Molecular weight | 294.35 g/mol |
| IUPAC name | tert-butyl N-[(2-methylpropan-2-yl)oxycarbonyl]-N-pyridin-2-ylcarbamate |
| InChIKey | QLOPVAOGSSBUEH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=CC=CC=N1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)