CAS 87075-01-2 is the registry number for 4,4,5,5-Tetrachloro-2,2-difluoro-1,3-dioxolane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4,4,5,5-tetrachloro-2,2-difluoro-1,3-dioxolane (CAS 87075-01-2) is a chemical compound with the molecular formula C3Cl4F2O2 and a molecular weight of 247.8 g/mol. IUPAC name: 4,4,5,5-tetrachloro-2,2-difluoro-1,3-dioxolane. InChIKey: IHFHXHCEXDIKMG-UHFFFAOYSA-N.
| Molecular formula | C3Cl4F2O2 |
|---|---|
| Molecular weight | 247.8 g/mol |
| IUPAC name | 4,4,5,5-tetrachloro-2,2-difluoro-1,3-dioxolane |
| InChIKey | IHFHXHCEXDIKMG-UHFFFAOYSA-N |
| SMILES | C1(C(OC(O1)(F)F)(Cl)Cl)(Cl)Cl |
Computed by PubChem (NCBI)