Products 87075-33-0

CAS 87075-33-0 is the registry number for 4-Hydroxy Propranolol Sulphate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-yl] hydrogen sulfate (CAS 87075-33-0) is a chemical compound with the molecular formula C16H21NO6S and a molecular weight of 355.4 g/mol. IUPAC name: [4-[2-hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-yl] hydrogen sulfate. InChIKey: ODCKICSDIPVTRM-UHFFFAOYSA-N.

Identity
Molecular formulaC16H21NO6S
Molecular weight355.4 g/mol
IUPAC name[4-[2-hydroxy-3-(propan-2-ylamino)propoxy]naphthalen-1-yl] hydrogen sulfate
InChIKeyODCKICSDIPVTRM-UHFFFAOYSA-N
SMILESCC(C)NCC(COC1=CC=C(C2=CC=CC=C21)OS(=O)(=O)O)O

Computed by PubChem (NCBI)