CAS 870766-48-6 is the registry number for 4-((1H-Benzo[d][1,2,3]triazol-1-yl)methyl)benzohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(benzotriazol-1-ylmethyl)benzohydrazide (CAS 870766-48-6) is a chemical compound with the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. IUPAC name: 4-(benzotriazol-1-ylmethyl)benzohydrazide. InChIKey: TZVOVBAYOUTXJE-UHFFFAOYSA-N.
| Molecular formula | C14H13N5O |
|---|---|
| Molecular weight | 267.29 g/mol |
| IUPAC name | 4-(benzotriazol-1-ylmethyl)benzohydrazide |
| InChIKey | TZVOVBAYOUTXJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=NN2CC3=CC=C(C=C3)C(=O)NN |
Computed by PubChem (NCBI)