CAS 870778-84-0 is the registry number for 4-[(4'-Chloro-1-naphthyloxy)methyl]phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[4-[(4-chloronaphthalen-1-yl)oxymethyl]phenyl]boronic acid (CAS 870778-84-0) is a chemical compound with the molecular formula C17H14BClO3 and a molecular weight of 312.6 g/mol. IUPAC name: [4-[(4-chloronaphthalen-1-yl)oxymethyl]phenyl]boronic acid. InChIKey: HFDWDXIYFHVORX-UHFFFAOYSA-N.
| Molecular formula | C17H14BClO3 |
|---|---|
| Molecular weight | 312.6 g/mol |
| IUPAC name | [4-[(4-chloronaphthalen-1-yl)oxymethyl]phenyl]boronic acid |
| InChIKey | HFDWDXIYFHVORX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)COC2=CC=C(C3=CC=CC=C32)Cl)(O)O |
Computed by PubChem (NCBI)