CAS 870778-99-7 is the registry number for 2,6-Difluoro-3-(2'-chlorobenzyloxy)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[3-[(2-chlorophenyl)methoxy]-2,6-difluorophenyl]boronic acid (CAS 870778-99-7) is a chemical compound with the molecular formula C13H10BClF2O3 and a molecular weight of 298.48 g/mol. IUPAC name: [3-[(2-chlorophenyl)methoxy]-2,6-difluorophenyl]boronic acid. InChIKey: VJXYERSPXBFRTA-UHFFFAOYSA-N.
| Molecular formula | C13H10BClF2O3 |
|---|---|
| Molecular weight | 298.48 g/mol |
| IUPAC name | [3-[(2-chlorophenyl)methoxy]-2,6-difluorophenyl]boronic acid |
| InChIKey | VJXYERSPXBFRTA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1F)OCC2=CC=CC=C2Cl)F)(O)O |
Computed by PubChem (NCBI)