CAS 87081-35-4 appears in our catalog under these names: Leptomycin B (5 μg/mL in Ethanol), Leptomycin B, >95% (HPLC), Leptomycin B/ 99.71% (existing batch purity), Leptomycin B, Leptomycin B. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 5x1ml, 0,1mg, 25ug, 5ug, 1mg, 2mg, 5mg, 10mg.
Leptomycin B is a leptomycin having a (2E,10E,12E,16Z,18E)-double bond configuration as well as an ethyl substituent at position 17. It has a role as an antifungal agent and a bacterial metabolite. It is a hydroxy polyunsaturated fatty acid and a leptomycin. It is functionally related to a tetracosanoic acid.
Source: ChEBI
| Molecular formula | C33H48O6 |
|---|---|
| Molecular weight | 540.7 g/mol |
| IUPAC name | (2E,5S,6R,7S,9R,10E,12E,15R,16Z,18E)-17-ethyl-6-hydroxy-3,5,7,9,11,15-hexamethyl-19-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]-8-oxononadeca-2,10,12,16,18-pentaenoic acid |
| InChIKey | YACHGFWEQXFSBS-XYERBDPFSA-N |
| SMILES | CC/C(=C/[C@H](C)C/C=C/C(=C/[C@@H](C)C(=O)[C@@H](C)[C@@H]([C@@H](C)C/C(=C/C(=O)O)/C)O)/C)/C=C/[C@H]1[C@H](C=CC(=O)O1)C |
Computed by PubChem (NCBI)