Products 870859-37-3
CAS 870859-37-3 is the registry number for 4-Methyl-2,6-bis((R)-1-phenylethyl)aniline, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
4-methyl-2,6-bis[(1R)-1-phenylethyl]aniline (CAS 870859-37-3) is a chemical compound with the molecular formula C23H25N and a molecular weight of 315.5 g/mol. IUPAC name: 4-methyl-2,6-bis[(1R)-1-phenylethyl]aniline. InChIKey: DKBNATUIDTYKOR-QZTJIDSGSA-N.
| Molecular formula | C23H25N |
|---|---|
| Molecular weight | 315.5 g/mol |
| IUPAC name | 4-methyl-2,6-bis[(1R)-1-phenylethyl]aniline |
| InChIKey | DKBNATUIDTYKOR-QZTJIDSGSA-N |
| SMILES | CC1=CC(=C(C(=C1)[C@H](C)C2=CC=CC=C2)N)[C@H](C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)