CAS 870860-41-6 is the registry number for FP0429. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
(2S,4S)-4-amino-1-[(E)-3-carboxyprop-2-enoyl]pyrrolidine-2,4-dicarboxylic acid (CAS 870860-41-6) is a chemical compound with the molecular formula C10H12N2O7 and a molecular weight of 272.21 g/mol. IUPAC name: (2S,4S)-4-amino-1-[(E)-3-carboxyprop-2-enoyl]pyrrolidine-2,4-dicarboxylic acid. InChIKey: ZALHFQNLXQORTH-FGLATXDZSA-N.
| Molecular formula | C10H12N2O7 |
|---|---|
| Molecular weight | 272.21 g/mol |
| IUPAC name | (2S,4S)-4-amino-1-[(E)-3-carboxyprop-2-enoyl]pyrrolidine-2,4-dicarboxylic acid |
| InChIKey | ZALHFQNLXQORTH-FGLATXDZSA-N |
| SMILES | C1[C@H](N(C[C@@]1(C(=O)O)N)C(=O)/C=C/C(=O)O)C(=O)O |
Computed by PubChem (NCBI)