CAS 870884-12-1 appears in our catalog under these names: Pparδ agonist 2, Pparδ agonist 2. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, Get quote.
2-[2-methyl-4-[[5-methyl-2-[4-(trifluoromethyl)phenyl]triazol-4-yl]methylsulfanyl]phenoxy]acetic acid (CAS 870884-12-1) is a chemical compound with the molecular formula C20H18F3N3O3S and a molecular weight of 437.4 g/mol. IUPAC name: 2-[2-methyl-4-[[5-methyl-2-[4-(trifluoromethyl)phenyl]triazol-4-yl]methylsulfanyl]phenoxy]acetic acid. InChIKey: XJHXZGHPCAKRFK-UHFFFAOYSA-N.
| Molecular formula | C20H18F3N3O3S |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | 2-[2-methyl-4-[[5-methyl-2-[4-(trifluoromethyl)phenyl]triazol-4-yl]methylsulfanyl]phenoxy]acetic acid |
| InChIKey | XJHXZGHPCAKRFK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)SCC2=NN(N=C2C)C3=CC=C(C=C3)C(F)(F)F)OCC(=O)O |
Computed by PubChem (NCBI)