CAS 871093-68-4 is the registry number for 2-((4,6-Diamino-1,3,5-triazin-2-yl)thio)-1-(pyrrolidin-1-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-1-pyrrolidin-1-ylethanone (CAS 871093-68-4) is a chemical compound with the molecular formula C9H14N6OS and a molecular weight of 254.32 g/mol. IUPAC name: 2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-1-pyrrolidin-1-ylethanone. InChIKey: YRMPNVHBIVYTQS-UHFFFAOYSA-N.
| Molecular formula | C9H14N6OS |
|---|---|
| Molecular weight | 254.32 g/mol |
| IUPAC name | 2-[(4,6-diamino-1,3,5-triazin-2-yl)sulfanyl]-1-pyrrolidin-1-ylethanone |
| InChIKey | YRMPNVHBIVYTQS-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C(=O)CSC2=NC(=NC(=N2)N)N |
Computed by PubChem (NCBI)