CAS 871125-81-4 appears in our catalog under these names: (3-Bromo-5-isopropoxyphenyl)boronic acid, 97%, (3–Bromo–5–isopropoxyphenyl)boronic acid, 3-Bromo-5-isopropoxyphenylboronic acid, 97%, 97%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
(3-bromo-5-propan-2-yloxyphenyl)boronic acid (CAS 871125-81-4) is a chemical compound with the molecular formula C9H12BBrO3 and a molecular weight of 258.91 g/mol. IUPAC name: (3-bromo-5-propan-2-yloxyphenyl)boronic acid. InChIKey: OYCQIPZXNTZLQQ-UHFFFAOYSA-N.
| Molecular formula | C9H12BBrO3 |
|---|---|
| Molecular weight | 258.91 g/mol |
| IUPAC name | (3-bromo-5-propan-2-yloxyphenyl)boronic acid |
| InChIKey | OYCQIPZXNTZLQQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)Br)OC(C)C)(O)O |
Computed by PubChem (NCBI)