CAS 87118-95-4 is the registry number for 3,4,5,6,6-Pentamethyl-2-heptanol. Offered by: TRC. Available pack sizes: 2,5g.
3,4,5,6,6-pentamethylheptan-2-ol (CAS 87118-95-4) is a chemical compound with the molecular formula C12H26O and a molecular weight of 186.33 g/mol. IUPAC name: 3,4,5,6,6-pentamethylheptan-2-ol. InChIKey: XEFKRPWKRQTXDA-UHFFFAOYSA-N.
| Molecular formula | C12H26O |
|---|---|
| Molecular weight | 186.33 g/mol |
| IUPAC name | 3,4,5,6,6-pentamethylheptan-2-ol |
| InChIKey | XEFKRPWKRQTXDA-UHFFFAOYSA-N |
| SMILES | CC(C(C)C(C)O)C(C)C(C)(C)C |
Computed by PubChem (NCBI)