Products 871217-81-1

CAS 871217-81-1 is the registry number for rac Styrene Glycol-d8. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1,1,2-trideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethane-1,2-diol (CAS 871217-81-1) is a chemical compound with the molecular formula C8H10O2 and a molecular weight of 146.21 g/mol. IUPAC name: 1,1,2-trideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethane-1,2-diol. InChIKey: PWMWNFMRSKOCEY-INHGFZCOSA-N.

Identity
Molecular formulaC8H10O2
Molecular weight146.21 g/mol
IUPAC name1,1,2-trideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethane-1,2-diol
InChIKeyPWMWNFMRSKOCEY-INHGFZCOSA-N
SMILES[2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])(C([2H])([2H])O)O)[2H])[2H]

Computed by PubChem (NCBI)