CAS 871217-81-1 is the registry number for rac Styrene Glycol-d8. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1,1,2-trideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethane-1,2-diol (CAS 871217-81-1) is a chemical compound with the molecular formula C8H10O2 and a molecular weight of 146.21 g/mol. IUPAC name: 1,1,2-trideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethane-1,2-diol. InChIKey: PWMWNFMRSKOCEY-INHGFZCOSA-N.
| Molecular formula | C8H10O2 |
|---|---|
| Molecular weight | 146.21 g/mol |
| IUPAC name | 1,1,2-trideuterio-2-(2,3,4,5,6-pentadeuteriophenyl)ethane-1,2-diol |
| InChIKey | PWMWNFMRSKOCEY-INHGFZCOSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])(C([2H])([2H])O)O)[2H])[2H] |
Computed by PubChem (NCBI)