Products 871218-26-7
CAS 871218-26-7 appears in our catalog under these names: WAY-660667, 98%, 2-((4-CARBAMOYLPHENYL)AMINO)-2-OXOETHYL 4,5,6,7-TETRAHYDROBENZO[B]THIOPHENE-3-CARBOXYLATE, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
[2-(4-carbamoylanilino)-2-oxoethyl] 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (CAS 871218-26-7) is a chemical compound with the molecular formula C18H18N2O4S and a molecular weight of 358.4 g/mol. IUPAC name: [2-(4-carbamoylanilino)-2-oxoethyl] 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate. InChIKey: GTAABKTZQGLVNE-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O4S |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | [2-(4-carbamoylanilino)-2-oxoethyl] 4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| InChIKey | GTAABKTZQGLVNE-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=CS2)C(=O)OCC(=O)NC3=CC=C(C=C3)C(=O)N |
Computed by PubChem (NCBI)