CAS 75062-54-3 appears in our catalog under these names: N-Tosyl-L-alanine 3-indoxyl ester, N-Tosyl-l-alanine 3-indoxyl ester, 98%, N-Tosyl-L-alanyloxyindole, >95% (HPLC), Taloxin, Taloxin 97%. Offered by: Biosynth, Combi-blocks, TRC, GLPBio, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 250mg, 100mg, 25mg.
1H-indol-3-yl (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate (CAS 75062-54-3) is a chemical compound with the molecular formula C18H18N2O4S and a molecular weight of 358.4 g/mol. IUPAC name: 1H-indol-3-yl (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate. InChIKey: CBIVSVOVPJAVRE-ZDUSSCGKSA-N.
| Molecular formula | C18H18N2O4S |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | 1H-indol-3-yl (2S)-2-[(4-methylphenyl)sulfonylamino]propanoate |
| InChIKey | CBIVSVOVPJAVRE-ZDUSSCGKSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N[C@@H](C)C(=O)OC2=CNC3=CC=CC=C32 |
Computed by PubChem (NCBI)