CAS 871231-24-2 appears in our catalog under these names: 7-(Methylthio)thiazolo[5,4-d]pyrimidine-2-carboxylic acid, 96%, 96%, 7-(Methylthio)thiazolo[5,4-d]pyrimidine-2-carboxylic acid, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxylic acid (CAS 871231-24-2) is a chemical compound with the molecular formula C7H5N3O2S2 and a molecular weight of 227.3 g/mol. IUPAC name: 7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxylic acid. InChIKey: HYCIWESBCQZHOI-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2S2 |
|---|---|
| Molecular weight | 227.3 g/mol |
| IUPAC name | 7-methylsulfanyl-[1,3]thiazolo[5,4-d]pyrimidine-2-carboxylic acid |
| InChIKey | HYCIWESBCQZHOI-UHFFFAOYSA-N |
| SMILES | CSC1=NC=NC2=C1N=C(S2)C(=O)O |
Computed by PubChem (NCBI)