CAS 871231-48-0 appears in our catalog under these names: (R)-(-)-1,1'-Bi(2-naphthyl) dimethanesulfonate, 95%, (R)-(1,1'-Binaphthalene)-2,2'-diyl dimethanesulfonate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
[2-(1-methylsulfonyloxynaphthalen-2-yl)naphthalen-1-yl] methanesulfonate (CAS 871231-48-0) is a chemical compound with the molecular formula C22H18O6S2 and a molecular weight of 442.5 g/mol. IUPAC name: [2-(1-methylsulfonyloxynaphthalen-2-yl)naphthalen-1-yl] methanesulfonate. InChIKey: NVLGJUMYNYDMQA-UHFFFAOYSA-N.
| Molecular formula | C22H18O6S2 |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | [2-(1-methylsulfonyloxynaphthalen-2-yl)naphthalen-1-yl] methanesulfonate |
| InChIKey | NVLGJUMYNYDMQA-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1=C(C=CC2=CC=CC=C21)C3=C(C4=CC=CC=C4C=C3)OS(=O)(=O)C |
Computed by PubChem (NCBI)