CAS 871266-83-0 is the registry number for (7-Chlorothiazolo[5,4-d]pyrimidin-2-yl)-(4-nitrophenyl)amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
7-chloro-N-(4-nitrophenyl)-[1,3]thiazolo[5,4-d]pyrimidin-2-amine (CAS 871266-83-0) is a chemical compound with the molecular formula C11H6ClN5O2S and a molecular weight of 307.72 g/mol. IUPAC name: 7-chloro-N-(4-nitrophenyl)-[1,3]thiazolo[5,4-d]pyrimidin-2-amine. InChIKey: AGBFROYZKVNMRB-UHFFFAOYSA-N.
| Molecular formula | C11H6ClN5O2S |
|---|---|
| Molecular weight | 307.72 g/mol |
| IUPAC name | 7-chloro-N-(4-nitrophenyl)-[1,3]thiazolo[5,4-d]pyrimidin-2-amine |
| InChIKey | AGBFROYZKVNMRB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=NC3=C(S2)N=CN=C3Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)