CAS 871325-55-2 is the registry number for MK-3984. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 1 mg.
(2R)-3,3,3-trifluoro-N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-hydroxy-2-phenylpropanamide (CAS 871325-55-2) is a chemical compound with the molecular formula C17H12F7NO2 and a molecular weight of 395.27 g/mol. IUPAC name: (2R)-3,3,3-trifluoro-N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-hydroxy-2-phenylpropanamide. InChIKey: YSMGNNKNGUPHCD-OAHLLOKOSA-N.
| Molecular formula | C17H12F7NO2 |
|---|---|
| Molecular weight | 395.27 g/mol |
| IUPAC name | (2R)-3,3,3-trifluoro-N-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-hydroxy-2-phenylpropanamide |
| InChIKey | YSMGNNKNGUPHCD-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)[C@@](C(=O)NCC2=C(C=CC(=C2)C(F)(F)F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)