Products 871332-85-3

CAS 871332-85-3 is the registry number for 3-(Cyclohexylaminocarbonyl)-5-nitrophenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[3-(cyclohexylcarbamoyl)-5-nitrophenyl]boronic acid (CAS 871332-85-3) is a chemical compound with the molecular formula C13H17BN2O5 and a molecular weight of 292.10 g/mol. IUPAC name: [3-(cyclohexylcarbamoyl)-5-nitrophenyl]boronic acid. InChIKey: QWXJHAUEXFJACW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17BN2O5
Molecular weight292.10 g/mol
IUPAC name[3-(cyclohexylcarbamoyl)-5-nitrophenyl]boronic acid
InChIKeyQWXJHAUEXFJACW-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)NC2CCCCC2)(O)O

Computed by PubChem (NCBI)