CAS 871332-85-3 is the registry number for 3-(Cyclohexylaminocarbonyl)-5-nitrophenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
[3-(cyclohexylcarbamoyl)-5-nitrophenyl]boronic acid (CAS 871332-85-3) is a chemical compound with the molecular formula C13H17BN2O5 and a molecular weight of 292.10 g/mol. IUPAC name: [3-(cyclohexylcarbamoyl)-5-nitrophenyl]boronic acid. InChIKey: QWXJHAUEXFJACW-UHFFFAOYSA-N.
| Molecular formula | C13H17BN2O5 |
|---|---|
| Molecular weight | 292.10 g/mol |
| IUPAC name | [3-(cyclohexylcarbamoyl)-5-nitrophenyl]boronic acid |
| InChIKey | QWXJHAUEXFJACW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)NC2CCCCC2)(O)O |
Computed by PubChem (NCBI)