Products 871338-41-9
CAS 871338-41-9 is the registry number for Ethyl 5-amino-1-(tert-butyl)-3-(trifluoromethyl)-1H-pyrazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-amino-1-tert-butyl-3-(trifluoromethyl)pyrazole-4-carboxylate (CAS 871338-41-9) is a chemical compound with the molecular formula C11H16F3N3O2 and a molecular weight of 279.26 g/mol. IUPAC name: ethyl 5-amino-1-tert-butyl-3-(trifluoromethyl)pyrazole-4-carboxylate. InChIKey: MFDCAYVUEFZJPH-UHFFFAOYSA-N.
| Molecular formula | C11H16F3N3O2 |
|---|---|
| Molecular weight | 279.26 g/mol |
| IUPAC name | ethyl 5-amino-1-tert-butyl-3-(trifluoromethyl)pyrazole-4-carboxylate |
| InChIKey | MFDCAYVUEFZJPH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1C(F)(F)F)C(C)(C)C)N |
Computed by PubChem (NCBI)