CAS 87145-66-2 appears in our catalog under these names: 1,3,5-Triazine-2,4,6-tricarboxylic acid, 98%, 1,3,5-TRIAZINE-2,4,6-TRICARBOXYLIC ACID, 98%+,RG, 98%+,RG. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg, 25mg, 100mg, 1g.
1,3,5-triazine-2,4,6-tricarboxylic acid (CAS 87145-66-2) is a chemical compound with the molecular formula C6H3N3O6 and a molecular weight of 213.10 g/mol. IUPAC name: 1,3,5-triazine-2,4,6-tricarboxylic acid. InChIKey: KIOHKYKNIXESSZ-UHFFFAOYSA-N.
| Molecular formula | C6H3N3O6 |
|---|---|
| Molecular weight | 213.10 g/mol |
| IUPAC name | 1,3,5-triazine-2,4,6-tricarboxylic acid |
| InChIKey | KIOHKYKNIXESSZ-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NC(=N1)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)