CAS 871478-79-4 is the registry number for 4-Amino-5-[(2,6-dichlorophenoxy)methyl]-4h-1,2,4-triazole-3-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-amino-3-[(2,6-dichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione (CAS 871478-79-4) is a chemical compound with the molecular formula C9H8Cl2N4OS and a molecular weight of 291.16 g/mol. IUPAC name: 4-amino-3-[(2,6-dichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione. InChIKey: GXQMAVWAJMZDRJ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2N4OS |
|---|---|
| Molecular weight | 291.16 g/mol |
| IUPAC name | 4-amino-3-[(2,6-dichlorophenoxy)methyl]-1H-1,2,4-triazole-5-thione |
| InChIKey | GXQMAVWAJMZDRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OCC2=NNC(=S)N2N)Cl |
Computed by PubChem (NCBI)