CAS 87150-13-8 appears in our catalog under these names: 4-(1,3-Oxazol-5-yl)benzonitrile, 97%, 4–(5–Oxazolyl)benzonitrile, 4-(5-Oxazolyl)benzonitrile 97%, 4-(5-Oxazolyl)benzonitrile, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
4-(1,3-oxazol-5-yl)benzonitrile (CAS 87150-13-8) is a chemical compound with the molecular formula C10H6N2O and a molecular weight of 170.17 g/mol. IUPAC name: 4-(1,3-oxazol-5-yl)benzonitrile. InChIKey: LZMCNLOQTURTHS-UHFFFAOYSA-N.
| Molecular formula | C10H6N2O |
|---|---|
| Molecular weight | 170.17 g/mol |
| IUPAC name | 4-(1,3-oxazol-5-yl)benzonitrile |
| InChIKey | LZMCNLOQTURTHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=CN=CO2 |
Computed by PubChem (NCBI)