CAS 871673-26-6 is the registry number for 3,5-Dichloro-2-methylpyrazolo(1,5-a)quinazoline. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3,5-dichloro-2-methylpyrazolo[1,5-a]quinazoline (CAS 871673-26-6) is a chemical compound with the molecular formula C11H7Cl2N3 and a molecular weight of 252.10 g/mol. IUPAC name: 3,5-dichloro-2-methylpyrazolo[1,5-a]quinazoline. InChIKey: BLKAQFDRUJKGDE-UHFFFAOYSA-N.
| Molecular formula | C11H7Cl2N3 |
|---|---|
| Molecular weight | 252.10 g/mol |
| IUPAC name | 3,5-dichloro-2-methylpyrazolo[1,5-a]quinazoline |
| InChIKey | BLKAQFDRUJKGDE-UHFFFAOYSA-N |
| SMILES | CC1=NN2C3=CC=CC=C3C(=NC2=C1Cl)Cl |
Computed by PubChem (NCBI)