Products 87186-60-5
CAS 87186-60-5 is the registry number for LY81067. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]piperidin-4-ol (CAS 87186-60-5) is a chemical compound with the molecular formula C22H24N4O and a molecular weight of 360.5 g/mol. IUPAC name: 1-[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]piperidin-4-ol. InChIKey: DIASUTCRTFLJTA-UHFFFAOYSA-N.
| Molecular formula | C22H24N4O |
|---|---|
| Molecular weight | 360.5 g/mol |
| IUPAC name | 1-[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]piperidin-4-ol |
| InChIKey | DIASUTCRTFLJTA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(N=NC(=N2)N3CCC(CC3)O)C4=CC=C(C=C4)C |
Computed by PubChem (NCBI)