CAS 871879-40-2 is the registry number for 1,3-Dibromo-5-methoxy-2,4-dinitrobenzene, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1,3-dibromo-5-methoxy-2,4-dinitrobenzene (CAS 871879-40-2) is a chemical compound with the molecular formula C7H4Br2N2O5 and a molecular weight of 355.92 g/mol. IUPAC name: 1,3-dibromo-5-methoxy-2,4-dinitrobenzene. InChIKey: FEXWYJQDTFVMSS-UHFFFAOYSA-N.
| Molecular formula | C7H4Br2N2O5 |
|---|---|
| Molecular weight | 355.92 g/mol |
| IUPAC name | 1,3-dibromo-5-methoxy-2,4-dinitrobenzene |
| InChIKey | FEXWYJQDTFVMSS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1[N+](=O)[O-])Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)