Products 871940-31-7
CAS 871940-31-7 appears in our catalog under these names: 2,4–Difluoro–3–cyanophenylboronic acid(contains varying amounts of Anhydride), 3-Cyano-2,4-difluorophenylboronic Acid (contains varying amounts of Anhydride), (3-Cyano-2,4-difluorophenyl)boronic acid 95%, Boronic acid, B-(3-cyano-2,4-difluorophenyl)-, 95%, 95%, (3-Cyano-2,4-difluorophenyl)boronic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 200mg, 250mg, 10g.
(3-cyano-2,4-difluorophenyl)boronic acid (CAS 871940-31-7) is a chemical compound with the molecular formula C7H4BF2NO2 and a molecular weight of 182.92 g/mol. IUPAC name: (3-cyano-2,4-difluorophenyl)boronic acid. InChIKey: VQEKFJVJHSVFTM-UHFFFAOYSA-N.
| Molecular formula | C7H4BF2NO2 |
|---|---|
| Molecular weight | 182.92 g/mol |
| IUPAC name | (3-cyano-2,4-difluorophenyl)boronic acid |
| InChIKey | VQEKFJVJHSVFTM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)F)C#N)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Cyano-2,4-difluorophenylboronic Acid (contains varying amounts of Anhydride), (3-Cyano-2,4-difluorophenyl)boronic acid, 2,4-Difluoro-3-cyanophenylboronic acid, 3-cyano-2,4-difluorophenylboronic acid, Boronic acid, B-(3-cyano-2,4-difluorophenyl)-, Boronic acid, (3-cyano-2,4-difluorophenyl)-, (3-Cyano-2,4-difluorophenyl)boronicacid, 3-Cyano-2,4-difluorobenzeneboronic Acid, (3-cyano-2,4-difluoro-phenyl)boronic acid, 3-Cyano-2,