CAS 872103-76-9 appears in our catalog under these names: 2,2,2-Trifluoroethyl N-(4-sulfamoylphenyl)carbamate, 95%, 2,2,2-Trifluoroethyl N-(4-sulfamoylphenyl)carbamate. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 2,5g.
2,2,2-trifluoroethyl N-(4-sulfamoylphenyl)carbamate (CAS 872103-76-9) is a chemical compound with the molecular formula C9H9F3N2O4S and a molecular weight of 298.24 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(4-sulfamoylphenyl)carbamate. InChIKey: JGMYLGVMFGZWCO-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O4S |
|---|---|
| Molecular weight | 298.24 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(4-sulfamoylphenyl)carbamate |
| InChIKey | JGMYLGVMFGZWCO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC(=O)OCC(F)(F)F)S(=O)(=O)N |
Computed by PubChem (NCBI)