CAS 872205-11-3 appears in our catalog under these names: 9-Mesityl-10-methylacridin-10-ium hexafluorophosphate(V), 97%, 97%, 9-mesityl-10-methylacridin-10-ium hexafluorophosphate, 97%, 9-Mesityl-10-methylacridin-10-ium hexafluorophosphate(V), 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium hexafluorophosphate (CAS 872205-11-3) is a chemical compound with the molecular formula C23H22F6NP and a molecular weight of 457.4 g/mol. IUPAC name: 10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium hexafluorophosphate. InChIKey: DZOVKULWDNOBBL-UHFFFAOYSA-N.
| Molecular formula | C23H22F6NP |
|---|---|
| Molecular weight | 457.4 g/mol |
| IUPAC name | 10-methyl-9-(2,4,6-trimethylphenyl)acridin-10-ium hexafluorophosphate |
| InChIKey | DZOVKULWDNOBBL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C2=C3C=CC=CC3=[N+](C4=CC=CC=C42)C)C.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)