CAS 872211-02-4 is the registry number for Boc-D-Cys(tBu)-OH 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
(2S)-3-tert-butylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 872211-02-4) is a chemical compound with the molecular formula C12H23NO4S and a molecular weight of 277.38 g/mol. IUPAC name: (2S)-3-tert-butylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: OGARKMDCQCLMCS-MRVPVSSYSA-N.
| Molecular formula | C12H23NO4S |
|---|---|
| Molecular weight | 277.38 g/mol |
| IUPAC name | (2S)-3-tert-butylsulfanyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | OGARKMDCQCLMCS-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CSC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)