CAS 872254-32-5 appears in our catalog under these names: Caspase–3–IN–1, Caspase-3-IN-1, 97%, 97%, Caspase-3-IN-1, 97.13%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 10mM (in 1ml dmso), 25mg, 5 mg, 10 mg, 25 mg, 10mM/1mL.
1-[(4-methoxyphenyl)methyl]-5-[(2S)-2-(pyridin-3-yloxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione (CAS 872254-32-5) is a chemical compound with the molecular formula C26H25N3O6S and a molecular weight of 507.6 g/mol. IUPAC name: 1-[(4-methoxyphenyl)methyl]-5-[(2S)-2-(pyridin-3-yloxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione. InChIKey: XDHJBIYJRNFDKS-IBGZPJMESA-N.
| Molecular formula | C26H25N3O6S |
|---|---|
| Molecular weight | 507.6 g/mol |
| IUPAC name | 1-[(4-methoxyphenyl)methyl]-5-[(2S)-2-(pyridin-3-yloxymethyl)pyrrolidin-1-yl]sulfonylindole-2,3-dione |
| InChIKey | XDHJBIYJRNFDKS-IBGZPJMESA-N |
| SMILES | COC1=CC=C(C=C1)CN2C3=C(C=C(C=C3)S(=O)(=O)N4CCC[C@H]4COC5=CN=CC=C5)C(=O)C2=O |
Computed by PubChem (NCBI)