CAS 87226-90-2 appears in our catalog under these names: 5'-(2-Formylphenyl)-[1,1':3',1''-terphenyl]-2,2''-dicarbaldehyde, 95%, 95%, 5'-(2-Formylphenyl)-[1,1':3',1''-terphenyl]-2,2''-dicarbaldehyde, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-[3,5-bis(2-formylphenyl)phenyl]benzaldehyde (CAS 87226-90-2) is a chemical compound with the molecular formula C27H18O3 and a molecular weight of 390.4 g/mol. IUPAC name: 2-[3,5-bis(2-formylphenyl)phenyl]benzaldehyde. InChIKey: DGYIFCHRANNJAE-UHFFFAOYSA-N.
| Molecular formula | C27H18O3 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 2-[3,5-bis(2-formylphenyl)phenyl]benzaldehyde |
| InChIKey | DGYIFCHRANNJAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)C2=CC(=CC(=C2)C3=CC=CC=C3C=O)C4=CC=CC=C4C=O |
Computed by PubChem (NCBI)