CAS 1395348-26-1 appears in our catalog under these names: 5'-(3-Formylphenyl)-[1,1':3',1''-terphenyl]-3,3''-dicarbaldehyde, 98%, 98%, 1,3,5-tris(3-Formylphenyl)benzene, 96%, 5'-(3-Formylphenyl)-[1,1':3',1''-terphenyl]-3,3''-dicarbaldehyde, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-[3,5-bis(3-formylphenyl)phenyl]benzaldehyde (CAS 1395348-26-1) is a chemical compound with the molecular formula C27H18O3 and a molecular weight of 390.4 g/mol. IUPAC name: 3-[3,5-bis(3-formylphenyl)phenyl]benzaldehyde. InChIKey: JKEVWAQYDZUIMU-UHFFFAOYSA-N.
| Molecular formula | C27H18O3 |
|---|---|
| Molecular weight | 390.4 g/mol |
| IUPAC name | 3-[3,5-bis(3-formylphenyl)phenyl]benzaldehyde |
| InChIKey | JKEVWAQYDZUIMU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC(=C2)C3=CC=CC(=C3)C=O)C4=CC=CC(=C4)C=O)C=O |
Computed by PubChem (NCBI)