CAS 872273-36-4 appears in our catalog under these names: 1,2-Bis(5-bromopyridin-2-yl)disulfane, 98%, 1,2-Bis(5-bromopyridin-2-yl)disulfane. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 1g, 2,5g.
5-bromo-2-[(5-bromo-2-pyridinyl)disulfanyl]pyridine (CAS 872273-36-4) is a chemical compound with the molecular formula C10H6Br2N2S2 and a molecular weight of 378.1 g/mol. IUPAC name: 5-bromo-2-[(5-bromo-2-pyridinyl)disulfanyl]pyridine. InChIKey: WURUVZBYROJMDO-UHFFFAOYSA-N.
| Molecular formula | C10H6Br2N2S2 |
|---|---|
| Molecular weight | 378.1 g/mol |
| IUPAC name | 5-bromo-2-[(5-bromo-2-pyridinyl)disulfanyl]pyridine |
| InChIKey | WURUVZBYROJMDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1Br)SSC2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)