CAS 872398-76-0 is the registry number for 2-Perfluorooctyl-(1,2-13C2)-Ethanoic Acid. Offered by: TRC. Available pack sizes: 25mg.
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro(1,2-13C2)decanoic acid (CAS 872398-76-0) is a chemical compound with the molecular formula C10H3F17O2 and a molecular weight of 480.09 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro(1,2-13C2)decanoic acid. InChIKey: XTBXSCIWOVSSGB-ZDOIIHCHSA-N.
| Molecular formula | C10H3F17O2 |
|---|---|
| Molecular weight | 480.09 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro(1,2-13C2)decanoic acid |
| InChIKey | XTBXSCIWOVSSGB-ZDOIIHCHSA-N |
| SMILES | [13CH2]([13C](=O)O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)