CAS 872398-79-3 is the registry number for 2H-Perfluoro-(1,2-13C2)-2-Decenoic Acid. Offered by: TRC. Available pack sizes: 50mg.
3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluoro(213C)dec-2-enoic acid (CAS 872398-79-3) is a chemical compound with the molecular formula C10H2F16O2 and a molecular weight of 459.09 g/mol. IUPAC name: 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluoro(213C)dec-2-enoic acid. InChIKey: WHZXTVOEGZRRJM-OUBTZVSYSA-N.
| Molecular formula | C10H2F16O2 |
|---|---|
| Molecular weight | 459.09 g/mol |
| IUPAC name | 3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluoro(213C)dec-2-enoic acid |
| InChIKey | WHZXTVOEGZRRJM-OUBTZVSYSA-N |
| SMILES | [13CH](=C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)