CAS 872467-80-6 is the registry number for 3-(3-Phenylpropyl)-2-thioxothiazolidin-4-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 872467-80-6) is a chemical compound with the molecular formula C12H13NOS2 and a molecular weight of 251.4 g/mol. IUPAC name: 3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: PIFOAVQKRIRPJC-UHFFFAOYSA-N.
| Molecular formula | C12H13NOS2 |
|---|---|
| Molecular weight | 251.4 g/mol |
| IUPAC name | 3-(3-phenylpropyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | PIFOAVQKRIRPJC-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=S)S1)CCCC2=CC=CC=C2 |
Computed by PubChem (NCBI)