CAS 872545-51-2 is the registry number for 5-Bromo-1,3-difluoro-2-[tris(1-methylethyl)silyl]benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-bromo-2,6-difluorophenyl)-tri(propan-2-yl)silane (CAS 872545-51-2) is a chemical compound with the molecular formula C15H23BrF2Si and a molecular weight of 349.33 g/mol. IUPAC name: (4-bromo-2,6-difluorophenyl)-tri(propan-2-yl)silane. InChIKey: ZJJUKGMYXQYTAM-UHFFFAOYSA-N.
| Molecular formula | C15H23BrF2Si |
|---|---|
| Molecular weight | 349.33 g/mol |
| IUPAC name | (4-bromo-2,6-difluorophenyl)-tri(propan-2-yl)silane |
| InChIKey | ZJJUKGMYXQYTAM-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C1=C(C=C(C=C1F)Br)F)(C(C)C)C(C)C |
Computed by PubChem (NCBI)