Products 872602-74-9

CAS 872602-74-9 appears in our catalog under these names: 6-Cyanopicolinic acid 98%, 6-Cyanopyridine-2-carboxylic acid, 95%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

6-cyanopyridine-2-carboxylic acid (CAS 872602-74-9) is a chemical compound with the molecular formula C7H4N2O2 and a molecular weight of 148.12 g/mol. IUPAC name: 6-cyanopyridine-2-carboxylic acid. InChIKey: NDFGHOYJWGPBEH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4N2O2
Molecular weight148.12 g/mol
IUPAC name6-cyanopyridine-2-carboxylic acid
InChIKeyNDFGHOYJWGPBEH-UHFFFAOYSA-N
SMILESC1=CC(=NC(=C1)C(=O)O)C#N

Computed by PubChem (NCBI)