CAS 872705-64-1 is the registry number for 2,8-Dibromo-6,6,12,12-tetramethyl-6,12-dihydroindeno[1,2-b]fluorene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,8-dibromo-6,6,12,12-tetramethylindeno[1,2-b]fluorene (CAS 872705-64-1) is a chemical compound with the molecular formula C24H20Br2 and a molecular weight of 468.2 g/mol. IUPAC name: 2,8-dibromo-6,6,12,12-tetramethylindeno[1,2-b]fluorene. InChIKey: NSRBXXWZFGGDPX-UHFFFAOYSA-N.
| Molecular formula | C24H20Br2 |
|---|---|
| Molecular weight | 468.2 g/mol |
| IUPAC name | 2,8-dibromo-6,6,12,12-tetramethylindeno[1,2-b]fluorene |
| InChIKey | NSRBXXWZFGGDPX-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC3=C(C=C2C4=C1C=C(C=C4)Br)C(C5=C3C=CC(=C5)Br)(C)C)C |
Computed by PubChem (NCBI)