CAS 872728-81-9 appears in our catalog under these names: Dabigatran Etexilate Mesylate, Dabigatran Etexilate Mesylate, >95% (HPLC), Dabigatran Etexilate Mesilate, Dabigatran Etexilate Mesylate/ 99.94% (existing batch purity), Dabigatran etexilate mesylate. Offered by: Chemat Brand, TRC, Mikromol, TargetMol, GLPBio. Available pack sizes: on request, 100mg, 1g, 500mg, 5mg, 10mg, 25mg, 50mg.
Ethyl 3-[[2-[[4-(N-hexoxycarbonylcarbamimidoyl)anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;methanesulfonic acid (CAS 872728-81-9) is a chemical compound with the molecular formula C35H45N7O8S and a molecular weight of 723.8 g/mol. IUPAC name: ethyl 3-[[2-[[4-(N-hexoxycarbonylcarbamimidoyl)anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;methanesulfonic acid. InChIKey: XETBXHPXHHOLOE-UHFFFAOYSA-N.
| Molecular formula | C35H45N7O8S |
|---|---|
| Molecular weight | 723.8 g/mol |
| IUPAC name | ethyl 3-[[2-[[4-(N-hexoxycarbonylcarbamimidoyl)anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoate;methanesulfonic acid |
| InChIKey | XETBXHPXHHOLOE-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)NC(=N)C1=CC=C(C=C1)NCC2=NC3=C(N2C)C=CC(=C3)C(=O)N(CCC(=O)OCC)C4=CC=CC=N4.CS(=O)(=O)O |
Computed by PubChem (NCBI)