CAS 872850-26-5 is the registry number for (S)-3-Chloro-1-(3,5-difluorophenyl)propan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-3-chloro-1-(3,5-difluorophenyl)propan-1-ol (CAS 872850-26-5) is a chemical compound with the molecular formula C9H9ClF2O and a molecular weight of 206.61 g/mol. IUPAC name: (1S)-3-chloro-1-(3,5-difluorophenyl)propan-1-ol. InChIKey: GCWYIIPGPAMLFZ-VIFPVBQESA-N.
| Molecular formula | C9H9ClF2O |
|---|---|
| Molecular weight | 206.61 g/mol |
| IUPAC name | (1S)-3-chloro-1-(3,5-difluorophenyl)propan-1-ol |
| InChIKey | GCWYIIPGPAMLFZ-VIFPVBQESA-N |
| SMILES | C1=C(C=C(C=C1F)F)[C@H](CCCl)O |
Computed by PubChem (NCBI)