Products 87304-15-2
CAS 87304-15-2 appears in our catalog under these names: (S)-2-((2S,3R)-3-((tert-Butoxycarbonyl)amino)-2-hydroxy-4-phenylbutanamido)-4-methylpentanoic acid, 97%, E3 ligase Ligand 9, E3 ligase Ligand 9, 98%. Offered by: Fluorochem, MedChemExpress, Chemat. Available pack sizes: 100mg, 250mg, 1g, 1 g, 50mg, 5g.
(2S)-2-[[(2S,3R)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoyl]amino]-4-methylpentanoic acid (CAS 87304-15-2) is a chemical compound with the molecular formula C21H32N2O6 and a molecular weight of 408.5 g/mol. IUPAC name: (2S)-2-[[(2S,3R)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoyl]amino]-4-methylpentanoic acid. InChIKey: DLADKYKXROHIAB-IKGGRYGDSA-N.
| Molecular formula | C21H32N2O6 |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | (2S)-2-[[(2S,3R)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoyl]amino]-4-methylpentanoic acid |
| InChIKey | DLADKYKXROHIAB-IKGGRYGDSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H]([C@@H](CC1=CC=CC=C1)NC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)
Synonyms:
E3 ligase Ligand 9, orb1909226