CAS 87328-92-5 appears in our catalog under these names: Sodium 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate, 95%, Sodium 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
Sodium 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate (CAS 87328-92-5) is a chemical compound with the molecular formula C5H3N2NaO3S and a molecular weight of 194.15 g/mol. IUPAC name: sodium 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate. InChIKey: SXMRGZZITXGQPN-UHFFFAOYSA-M.
| Molecular formula | C5H3N2NaO3S |
|---|---|
| Molecular weight | 194.15 g/mol |
| IUPAC name | sodium 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate |
| InChIKey | SXMRGZZITXGQPN-UHFFFAOYSA-M |
| SMILES | C1=C(N=C(S1)N)C(=O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)